C18H18BrNO3 — CID 51539659
(3S)-5-bromo-3-[(2,3-dimethoxyphenyl)methyl]-1-methyl-3H-indol-2-one (PubChem CID 51539659) has the molecular formula C18H18BrNO3 and a molecular weight of 376.25 g/mol. Its IUPAC name is (3S)-5-bromo-3-[(2,3-dimethoxyphenyl)methyl]-1-methyl-3H-indol-2-one.
| Compound Name | (3S)-5-bromo-3-[(2,3-dimethoxyphenyl)methyl]-1-methyl-3H-indol-2-one |
|---|---|
| PubChem CID | 51539659 |
| Molecular Formula | C18H18BrNO3 |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | (3S)-5-bromo-3-[(2,3-dimethoxyphenyl)methyl]-1-methyl-3H-indol-2-one |
| SMILES | COc1cccc(C[C@@H]2C(=O)N(C)c3ccc(Br)cc32)c1OC |
| InChI | InChI=1S/C18H18BrNO3/c1-20-15-8-7-12(19)10-13(15)14(18(20)21)9-11-5-4-6-16(22-2)17(11)23-3/h4-8,10,14H,9H2,1-3H3/t14-/m0/s1 |
| InChIKey | QLUQVMFWNOMERC-AWEZNQCLSA-N |
| XLogP | 3.77 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |