C26H26N2O5 — CID 10623254
(5S)-5-benzyl-3-phenyl-1-[(3,4,5-trimethoxyphenyl)methyl]imidazolidine-2,4-dione (PubChem CID 10623254) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is (5S)-5-benzyl-3-phenyl-1-[(3,4,5-trimethoxyphenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-benzyl-3-phenyl-1-[(3,4,5-trimethoxyphenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 10623254 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | (5S)-5-benzyl-3-phenyl-1-[(3,4,5-trimethoxyphenyl)methyl]imidazolidine-2,4-dione |
| SMILES | COc1cc(CN2C(=O)N(c3ccccc3)C(=O)[C@@H]2Cc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C26H26N2O5/c1-31-22-15-19(16-23(32-2)24(22)33-3)17-27-21(14-18-10-6-4-7-11-18)25(29)28(26(27)30)20-12-8-5-9-13-20/h4-13,15-16,21H,14,17H2,1-3H3/t21-/m0/s1 |
| InChIKey | BAIAXJLIXQIFKP-NRFANRHFSA-N |
| XLogP | 4.29 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|