C25H22N2O5 — CID 57422389
4-[4-benzyl-3-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-1-yl]benzoic acid (PubChem CID 57422389) has the molecular formula C25H22N2O5 and a molecular weight of 430.46 g/mol. Its IUPAC name is 4-[4-benzyl-3-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-1-yl]benzoic acid.
| Compound Name | 4-[4-benzyl-3-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 57422389 |
| Molecular Formula | C25H22N2O5 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 4-[4-benzyl-3-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-1-yl]benzoic acid |
| SMILES | COc1ccc(CN2C(=O)N(c3ccc(C(=O)O)cc3)C(=O)C2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C25H22N2O5/c1-32-21-13-7-18(8-14-21)16-26-22(15-17-5-3-2-4-6-17)23(28)27(25(26)31)20-11-9-19(10-12-20)24(29)30/h2-14,22H,15-16H2,1H3,(H,29,30) |
| InChIKey | DXYDFYQBVRQNBO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|