C28H27N3O6 — CID 28698501
ethyl 4-[[2-[(4S)-3-[(4-methoxyphenyl)methyl]-2,5-dioxo-1-phenylimidazolidin-4-yl]acetyl]amino]benzoate (PubChem CID 28698501) has the molecular formula C28H27N3O6 and a molecular weight of 501.54 g/mol. Its IUPAC name is ethyl 4-[[2-[(4S)-3-[(4-methoxyphenyl)methyl]-2,5-dioxo-1-phenylimidazolidin-4-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(4S)-3-[(4-methoxyphenyl)methyl]-2,5-dioxo-1-phenylimidazolidin-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 28698501 |
| Molecular Formula | C28H27N3O6 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | ethyl 4-[[2-[(4S)-3-[(4-methoxyphenyl)methyl]-2,5-dioxo-1-phenylimidazolidin-4-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C[C@H]2C(=O)N(c3ccccc3)C(=O)N2Cc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C28H27N3O6/c1-3-37-27(34)20-11-13-21(14-12-20)29-25(32)17-24-26(33)31(22-7-5-4-6-8-22)28(35)30(24)18-19-9-15-23(36-2)16-10-19/h4-16,24H,3,17-18H2,1-2H3,(H,29,32)/t24-/m0/s1 |
| InChIKey | CGSSYDMQEKTMRC-DEOSSOPVSA-N |
| XLogP | 4.24 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|