C30H31N3O7 — CID 94856434
ethyl 4-[[2-[(4S)-3-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxo-1-phenylimidazolidin-4-yl]acetyl]amino]benzoate (PubChem CID 94856434) has the molecular formula C30H31N3O7 and a molecular weight of 545.59 g/mol. Its IUPAC name is ethyl 4-[[2-[(4S)-3-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxo-1-phenylimidazolidin-4-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(4S)-3-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxo-1-phenylimidazolidin-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 94856434 |
| Molecular Formula | C30H31N3O7 |
| Molecular Weight | 545.59 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | ethyl 4-[[2-[(4S)-3-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxo-1-phenylimidazolidin-4-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C[C@H]2C(=O)N(c3ccccc3)C(=O)N2CCc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C30H31N3O7/c1-4-40-29(36)21-11-13-22(14-12-21)31-27(34)19-24-28(35)33(23-8-6-5-7-9-23)30(37)32(24)17-16-20-10-15-25(38-2)26(18-20)39-3/h5-15,18,24H,4,16-17,19H2,1-3H3,(H,31,34)/t24-/m0/s1 |
| InChIKey | YFBOSNSKIILRCR-DEOSSOPVSA-N |
| XLogP | 4.29 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.59 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|