C19H18N2O4 — CID 156703245
methyl 4-[(4S)-3-benzyl-4-methyl-2,5-dioxoimidazolidin-1-yl]benzoate (PubChem CID 156703245) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is methyl 4-[(4S)-3-benzyl-4-methyl-2,5-dioxoimidazolidin-1-yl]benzoate.
| Compound Name | methyl 4-[(4S)-3-benzyl-4-methyl-2,5-dioxoimidazolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 156703245 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | methyl 4-[(4S)-3-benzyl-4-methyl-2,5-dioxoimidazolidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)[C@H](C)N(Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C19H18N2O4/c1-13-17(22)21(16-10-8-15(9-11-16)18(23)25-2)19(24)20(13)12-14-6-4-3-5-7-14/h3-11,13H,12H2,1-2H3/t13-/m0/s1 |
| InChIKey | QWAXQUNYSKYBRH-ZDUSSCGKSA-N |
| XLogP | 2.83 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|