C17H16N2O3 — CID 156703188
(5S)-1-benzyl-3-(4-hydroxyphenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 156703188) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is (5S)-1-benzyl-3-(4-hydroxyphenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-1-benzyl-3-(4-hydroxyphenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 156703188 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (5S)-1-benzyl-3-(4-hydroxyphenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@H]1C(=O)N(c2ccc(O)cc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C17H16N2O3/c1-12-16(21)19(14-7-9-15(20)10-8-14)17(22)18(12)11-13-5-3-2-4-6-13/h2-10,12,20H,11H2,1H3/t12-/m0/s1 |
| InChIKey | FQMRXUZRAMPTSY-LBPRGKRZSA-N |
| XLogP | 2.75 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|