C18H14ClN3O2 — CID 156703195
4-[[(5S)-3-(4-chlorophenyl)-5-methyl-2,4-dioxoimidazolidin-1-yl]methyl]benzonitrile (PubChem CID 156703195) has the molecular formula C18H14ClN3O2 and a molecular weight of 339.78 g/mol. Its IUPAC name is 4-[[(5S)-3-(4-chlorophenyl)-5-methyl-2,4-dioxoimidazolidin-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[(5S)-3-(4-chlorophenyl)-5-methyl-2,4-dioxoimidazolidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 156703195 |
| Molecular Formula | C18H14ClN3O2 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 4-[[(5S)-3-(4-chlorophenyl)-5-methyl-2,4-dioxoimidazolidin-1-yl]methyl]benzonitrile |
| SMILES | C[C@H]1C(=O)N(c2ccc(Cl)cc2)C(=O)N1Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C18H14ClN3O2/c1-12-17(23)22(16-8-6-15(19)7-9-16)18(24)21(12)11-14-4-2-13(10-20)3-5-14/h2-9,12H,11H2,1H3/t12-/m0/s1 |
| InChIKey | VGWNGUBFFGBEFA-LBPRGKRZSA-N |
| XLogP | 3.57 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|