C24H18ClF2N3O3 — CID 92666411
N-(4-chlorophenyl)-2-[(4S)-1-(4-fluorophenyl)-3-[(4-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]acetamide (PubChem CID 92666411) has the molecular formula C24H18ClF2N3O3 and a molecular weight of 469.88 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(4S)-1-(4-fluorophenyl)-3-[(4-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[(4S)-1-(4-fluorophenyl)-3-[(4-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]acetamide |
|---|---|
| PubChem CID | 92666411 |
| Molecular Formula | C24H18ClF2N3O3 |
| Molecular Weight | 469.88 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(4S)-1-(4-fluorophenyl)-3-[(4-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]acetamide |
| SMILES | O=C(C[C@H]1C(=O)N(c2ccc(F)cc2)C(=O)N1Cc1ccc(F)cc1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H18ClF2N3O3/c25-16-3-9-19(10-4-16)28-22(31)13-21-23(32)30(20-11-7-18(27)8-12-20)24(33)29(21)14-15-1-5-17(26)6-2-15/h1-12,21H,13-14H2,(H,28,31)/t21-/m0/s1 |
| InChIKey | OSUVBVLOANLHQL-NRFANRHFSA-N |
| XLogP | 4.98 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.88 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|