C22H17ClFN3O4 — CID 17118493
2-[1-(4-chlorophenyl)-3-(furan-2-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 17118493) has the molecular formula C22H17ClFN3O4 and a molecular weight of 441.85 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)-3-(furan-2-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[1-(4-chlorophenyl)-3-(furan-2-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 17118493 |
| Molecular Formula | C22H17ClFN3O4 |
| Molecular Weight | 441.85 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 2-[1-(4-chlorophenyl)-3-(furan-2-ylmethyl)-2,5-dioxoimidazolidin-4-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(CC1C(=O)N(c2ccc(Cl)cc2)C(=O)N1Cc1ccco1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C22H17ClFN3O4/c23-14-3-9-17(10-4-14)27-21(29)19(26(22(27)30)13-18-2-1-11-31-18)12-20(28)25-16-7-5-15(24)6-8-16/h1-11,19H,12-13H2,(H,25,28) |
| InChIKey | SQAJLQHLCLYURW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.85 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|