C24H20ClN3O6 — CID 40774523
methyl 4-[[2-[(4S)-1-(4-chlorophenyl)-3-(furan-2-ylmethyl)-2,5-dioxoimidazolidin-4-yl]acetyl]amino]benzoate (PubChem CID 40774523) has the molecular formula C24H20ClN3O6 and a molecular weight of 481.89 g/mol. Its IUPAC name is methyl 4-[[2-[(4S)-1-(4-chlorophenyl)-3-(furan-2-ylmethyl)-2,5-dioxoimidazolidin-4-yl]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[(4S)-1-(4-chlorophenyl)-3-(furan-2-ylmethyl)-2,5-dioxoimidazolidin-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 40774523 |
| Molecular Formula | C24H20ClN3O6 |
| Molecular Weight | 481.89 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | methyl 4-[[2-[(4S)-1-(4-chlorophenyl)-3-(furan-2-ylmethyl)-2,5-dioxoimidazolidin-4-yl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C[C@H]2C(=O)N(c3ccc(Cl)cc3)C(=O)N2Cc2ccco2)cc1 |
| InChI | InChI=1S/C24H20ClN3O6/c1-33-23(31)15-4-8-17(9-5-15)26-21(29)13-20-22(30)28(18-10-6-16(25)7-11-18)24(32)27(20)14-19-3-2-12-34-19/h2-12,20H,13-14H2,1H3,(H,26,29)/t20-/m0/s1 |
| InChIKey | PDICRKHOLCUKBK-FQEVSTJZSA-N |
| XLogP | 4.09 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.89 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|