C25H25N3O7 — CID 41284981
N-(3,5-dimethoxyphenyl)-2-[(4R)-3-(furan-2-ylmethyl)-1-(4-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]acetamide (PubChem CID 41284981) has the molecular formula C25H25N3O7 and a molecular weight of 479.49 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-2-[(4R)-3-(furan-2-ylmethyl)-1-(4-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]acetamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-2-[(4R)-3-(furan-2-ylmethyl)-1-(4-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]acetamide |
|---|---|
| PubChem CID | 41284981 |
| Molecular Formula | C25H25N3O7 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-2-[(4R)-3-(furan-2-ylmethyl)-1-(4-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]acetamide |
| SMILES | COc1ccc(N2C(=O)[C@@H](CC(=O)Nc3cc(OC)cc(OC)c3)N(Cc3ccco3)C2=O)cc1 |
| InChI | InChI=1S/C25H25N3O7/c1-32-18-8-6-17(7-9-18)28-24(30)22(27(25(28)31)15-19-5-4-10-35-19)14-23(29)26-16-11-20(33-2)13-21(12-16)34-3/h4-13,22H,14-15H2,1-3H3,(H,26,29)/t22-/m1/s1 |
| InChIKey | GQEYSQOFLCMYCX-JOCHJYFZSA-N |
| XLogP | 3.67 |
| TPSA | 110.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|