C24H23N3O6 — CID 5023637
2-[3-(furan-2-ylmethyl)-1-(3-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 5023637) has the molecular formula C24H23N3O6 and a molecular weight of 449.46 g/mol. Its IUPAC name is 2-[3-(furan-2-ylmethyl)-1-(3-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[3-(furan-2-ylmethyl)-1-(3-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 5023637 |
| Molecular Formula | C24H23N3O6 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 2-[3-(furan-2-ylmethyl)-1-(3-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CC2C(=O)N(c3cccc(OC)c3)C(=O)N2Cc2ccco2)cc1 |
| InChI | InChI=1S/C24H23N3O6/c1-31-18-10-8-16(9-11-18)25-22(28)14-21-23(29)27(17-5-3-6-19(13-17)32-2)24(30)26(21)15-20-7-4-12-33-20/h3-13,21H,14-15H2,1-2H3,(H,25,28) |
| InChIKey | LGMTXFVNHIKDKD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 101.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|