C25H25N3O6 — CID 17118474
N-(4-ethoxyphenyl)-2-[3-(furan-2-ylmethyl)-1-(4-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]acetamide (PubChem CID 17118474) has the molecular formula C25H25N3O6 and a molecular weight of 463.49 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-[3-(furan-2-ylmethyl)-1-(4-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]acetamide.
| Compound Name | N-(4-ethoxyphenyl)-2-[3-(furan-2-ylmethyl)-1-(4-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]acetamide |
|---|---|
| PubChem CID | 17118474 |
| Molecular Formula | C25H25N3O6 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-[3-(furan-2-ylmethyl)-1-(4-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]acetamide |
| SMILES | CCOc1ccc(NC(=O)CC2C(=O)N(c3ccc(OC)cc3)C(=O)N2Cc2ccco2)cc1 |
| InChI | InChI=1S/C25H25N3O6/c1-3-33-20-10-6-17(7-11-20)26-23(29)15-22-24(30)28(18-8-12-19(32-2)13-9-18)25(31)27(22)16-21-5-4-14-34-21/h4-14,22H,3,15-16H2,1-2H3,(H,26,29) |
| InChIKey | MOVCFARKQYWTFT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 101.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|