C27H26FN3O5 — CID 5296381
N-(4-ethoxyphenyl)-2-[3-[(3-fluorophenyl)methyl]-1-(4-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]acetamide (PubChem CID 5296381) has the molecular formula C27H26FN3O5 and a molecular weight of 491.52 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-[3-[(3-fluorophenyl)methyl]-1-(4-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]acetamide.
| Compound Name | N-(4-ethoxyphenyl)-2-[3-[(3-fluorophenyl)methyl]-1-(4-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]acetamide |
|---|---|
| PubChem CID | 5296381 |
| Molecular Formula | C27H26FN3O5 |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-[3-[(3-fluorophenyl)methyl]-1-(4-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]acetamide |
| SMILES | CCOc1ccc(NC(=O)CC2C(=O)N(c3ccc(OC)cc3)C(=O)N2Cc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C27H26FN3O5/c1-3-36-23-11-7-20(8-12-23)29-25(32)16-24-26(33)31(21-9-13-22(35-2)14-10-21)27(34)30(24)17-18-5-4-6-19(28)15-18/h4-15,24H,3,16-17H2,1-2H3,(H,29,32) |
| InChIKey | JPRCCWDFNXJVJA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|