C25H21ClFN3O4 — CID 46276974
2-[1-(4-chlorophenyl)-3-[(3-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(3-fluorophenyl)acetamide (PubChem CID 46276974) has the molecular formula C25H21ClFN3O4 and a molecular weight of 481.91 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)-3-[(3-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[1-(4-chlorophenyl)-3-[(3-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 46276974 |
| Molecular Formula | C25H21ClFN3O4 |
| Molecular Weight | 481.91 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | 2-[1-(4-chlorophenyl)-3-[(3-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(3-fluorophenyl)acetamide |
| SMILES | COc1cccc(CN2C(=O)N(c3ccc(Cl)cc3)C(=O)C2CC(=O)Nc2cccc(F)c2)c1 |
| InChI | InChI=1S/C25H21ClFN3O4/c1-34-21-7-2-4-16(12-21)15-29-22(14-23(31)28-19-6-3-5-18(27)13-19)24(32)30(25(29)33)20-10-8-17(26)9-11-20/h2-13,22H,14-15H2,1H3,(H,28,31) |
| InChIKey | ALMQXGSRRLSFIP-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.91 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|