C20H19F2N3O3 — CID 2980060
N-ethyl-2-[1-(4-fluorophenyl)-3-[(4-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]acetamide (PubChem CID 2980060) has the molecular formula C20H19F2N3O3 and a molecular weight of 387.39 g/mol. Its IUPAC name is N-ethyl-2-[1-(4-fluorophenyl)-3-[(4-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]acetamide.
| Compound Name | N-ethyl-2-[1-(4-fluorophenyl)-3-[(4-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]acetamide |
|---|---|
| PubChem CID | 2980060 |
| Molecular Formula | C20H19F2N3O3 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | N-ethyl-2-[1-(4-fluorophenyl)-3-[(4-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]acetamide |
| SMILES | CCNC(=O)CC1C(=O)N(c2ccc(F)cc2)C(=O)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C20H19F2N3O3/c1-2-23-18(26)11-17-19(27)25(16-9-7-15(22)8-10-16)20(28)24(17)12-13-3-5-14(21)6-4-13/h3-10,17H,2,11-12H2,1H3,(H,23,26) |
| InChIKey | NUXYKGUPCQEZTC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|