C16H20FN3O4 — CID 2236087
N-ethyl-2-[(4R)-1-(4-fluorophenyl)-3-(2-methoxyethyl)-2,5-dioxoimidazolidin-4-yl]acetamide (PubChem CID 2236087) has the molecular formula C16H20FN3O4 and a molecular weight of 337.35 g/mol. Its IUPAC name is N-ethyl-2-[(4R)-1-(4-fluorophenyl)-3-(2-methoxyethyl)-2,5-dioxoimidazolidin-4-yl]acetamide.
| Compound Name | N-ethyl-2-[(4R)-1-(4-fluorophenyl)-3-(2-methoxyethyl)-2,5-dioxoimidazolidin-4-yl]acetamide |
|---|---|
| PubChem CID | 2236087 |
| Molecular Formula | C16H20FN3O4 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | N-ethyl-2-[(4R)-1-(4-fluorophenyl)-3-(2-methoxyethyl)-2,5-dioxoimidazolidin-4-yl]acetamide |
| SMILES | CCNC(=O)C[C@@H]1C(=O)N(c2ccc(F)cc2)C(=O)N1CCOC |
| InChI | InChI=1S/C16H20FN3O4/c1-3-18-14(21)10-13-15(22)20(12-6-4-11(17)5-7-12)16(23)19(13)8-9-24-2/h4-7,13H,3,8-10H2,1-2H3,(H,18,21)/t13-/m1/s1 |
| InChIKey | PDNSKTSYRXTMNX-CYBMUJFWSA-N |
| XLogP | 1.14 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|