C17H15NO3 — CID 804537
(3R)-3-benzyl-1-(4-hydroxyphenyl)pyrrolidine-2,5-dione (PubChem CID 804537) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is (3R)-3-benzyl-1-(4-hydroxyphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-benzyl-1-(4-hydroxyphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 804537 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | (3R)-3-benzyl-1-(4-hydroxyphenyl)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H](Cc2ccccc2)C(=O)N1c1ccc(O)cc1 |
| InChI | InChI=1S/C17H15NO3/c19-15-8-6-14(7-9-15)18-16(20)11-13(17(18)21)10-12-4-2-1-3-5-12/h1-9,13,19H,10-11H2/t13-/m1/s1 |
| InChIKey | AJCRDXAKXVCCSA-CYBMUJFWSA-N |
| XLogP | 2.51 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|