C23H18ClNO2 — CID 3133545
3-[(4-chlorophenyl)methyl]-1-(4-phenylphenyl)pyrrolidine-2,5-dione (PubChem CID 3133545) has the molecular formula C23H18ClNO2 and a molecular weight of 375.86 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl]-1-(4-phenylphenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-[(4-chlorophenyl)methyl]-1-(4-phenylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 3133545 |
| Molecular Formula | C23H18ClNO2 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl]-1-(4-phenylphenyl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(Cc2ccc(Cl)cc2)C(=O)N1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H18ClNO2/c24-20-10-6-16(7-11-20)14-19-15-22(26)25(23(19)27)21-12-8-18(9-13-21)17-4-2-1-3-5-17/h1-13,19H,14-15H2 |
| InChIKey | JMOFDANCFLDMPT-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|