C28H24N2O7 — CID 58257327
methyl 4-[3-[3-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxo-1-phenylimidazolidin-4-yl]-2-oxopropyl]benzoate (PubChem CID 58257327) has the molecular formula C28H24N2O7 and a molecular weight of 500.51 g/mol. Its IUPAC name is methyl 4-[3-[3-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxo-1-phenylimidazolidin-4-yl]-2-oxopropyl]benzoate.
| Compound Name | methyl 4-[3-[3-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxo-1-phenylimidazolidin-4-yl]-2-oxopropyl]benzoate |
|---|---|
| PubChem CID | 58257327 |
| Molecular Formula | C28H24N2O7 |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | methyl 4-[3-[3-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxo-1-phenylimidazolidin-4-yl]-2-oxopropyl]benzoate |
| SMILES | COC(=O)c1ccc(CC(=O)CC2C(=O)N(c3ccccc3)C(=O)N2Cc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C28H24N2O7/c1-35-27(33)20-10-7-18(8-11-20)13-22(31)15-23-26(32)30(21-5-3-2-4-6-21)28(34)29(23)16-19-9-12-24-25(14-19)37-17-36-24/h2-12,14,23H,13,15-17H2,1H3 |
| InChIKey | BDXXNMUKYOENAC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|