C27H23N3O7 — CID 2949727
methyl 4-[[2-[3-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxo-1-phenylimidazolidin-4-yl]acetyl]amino]benzoate (PubChem CID 2949727) has the molecular formula C27H23N3O7 and a molecular weight of 501.50 g/mol. Its IUPAC name is methyl 4-[[2-[3-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxo-1-phenylimidazolidin-4-yl]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[3-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxo-1-phenylimidazolidin-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 2949727 |
| Molecular Formula | C27H23N3O7 |
| Molecular Weight | 501.50 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | methyl 4-[[2-[3-(1,3-benzodioxol-5-ylmethyl)-2,5-dioxo-1-phenylimidazolidin-4-yl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CC2C(=O)N(c3ccccc3)C(=O)N2Cc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C27H23N3O7/c1-35-26(33)18-8-10-19(11-9-18)28-24(31)14-21-25(32)30(20-5-3-2-4-6-20)27(34)29(21)15-17-7-12-22-23(13-17)37-16-36-22/h2-13,21H,14-16H2,1H3,(H,28,31) |
| InChIKey | VZMCOWAOUATIPC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|