C27H24ClN3O6 — CID 4033035
2-[3-(1,3-benzodioxol-5-ylmethyl)-1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]-N-(3-ethoxyphenyl)acetamide (PubChem CID 4033035) has the molecular formula C27H24ClN3O6 and a molecular weight of 521.96 g/mol. Its IUPAC name is 2-[3-(1,3-benzodioxol-5-ylmethyl)-1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]-N-(3-ethoxyphenyl)acetamide.
| Compound Name | 2-[3-(1,3-benzodioxol-5-ylmethyl)-1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]-N-(3-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 4033035 |
| Molecular Formula | C27H24ClN3O6 |
| Molecular Weight | 521.96 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | 2-[3-(1,3-benzodioxol-5-ylmethyl)-1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]-N-(3-ethoxyphenyl)acetamide |
| SMILES | CCOc1cccc(NC(=O)CC2C(=O)N(c3ccc(Cl)cc3)C(=O)N2Cc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C27H24ClN3O6/c1-2-35-21-5-3-4-19(13-21)29-25(32)14-22-26(33)31(20-9-7-18(28)8-10-20)27(34)30(22)15-17-6-11-23-24(12-17)37-16-36-23/h3-13,22H,2,14-16H2,1H3,(H,29,32) |
| InChIKey | KONDZAYRXNJIER-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.96 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|