C21H20BrN3O2 — CID 92716945
2-[[(3R)-5-bromo-1-ethyl-2-oxo-3H-indol-3-yl]methyl]-3-ethylquinazolin-4-one (PubChem CID 92716945) has the molecular formula C21H20BrN3O2 and a molecular weight of 426.31 g/mol. Its IUPAC name is 2-[[(3R)-5-bromo-1-ethyl-2-oxo-3H-indol-3-yl]methyl]-3-ethylquinazolin-4-one.
| Compound Name | 2-[[(3R)-5-bromo-1-ethyl-2-oxo-3H-indol-3-yl]methyl]-3-ethylquinazolin-4-one |
|---|---|
| PubChem CID | 92716945 |
| Molecular Formula | C21H20BrN3O2 |
| Molecular Weight | 426.31 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | 2-[[(3R)-5-bromo-1-ethyl-2-oxo-3H-indol-3-yl]methyl]-3-ethylquinazolin-4-one |
| SMILES | CCN1C(=O)[C@H](Cc2nc3ccccc3c(=O)n2CC)c2cc(Br)ccc21 |
| InChI | InChI=1S/C21H20BrN3O2/c1-3-24-18-10-9-13(22)11-15(18)16(21(24)27)12-19-23-17-8-6-5-7-14(17)20(26)25(19)4-2/h5-11,16H,3-4,12H2,1-2H3/t16-/m1/s1 |
| InChIKey | YXWIKWOMICUERL-MRXNPFEDSA-N |
| XLogP | 3.87 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.31 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |