C18H18BrNOS — CID 26367872
(3R)-5-bromo-1-ethyl-3-[(4-methylsulfanylphenyl)methyl]-3H-indol-2-one (PubChem CID 26367872) has the molecular formula C18H18BrNOS and a molecular weight of 376.32 g/mol. Its IUPAC name is (3R)-5-bromo-1-ethyl-3-[(4-methylsulfanylphenyl)methyl]-3H-indol-2-one.
| Compound Name | (3R)-5-bromo-1-ethyl-3-[(4-methylsulfanylphenyl)methyl]-3H-indol-2-one |
|---|---|
| PubChem CID | 26367872 |
| Molecular Formula | C18H18BrNOS |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | (3R)-5-bromo-1-ethyl-3-[(4-methylsulfanylphenyl)methyl]-3H-indol-2-one |
| SMILES | CCN1C(=O)[C@H](Cc2ccc(SC)cc2)c2cc(Br)ccc21 |
| InChI | InChI=1S/C18H18BrNOS/c1-3-20-17-9-6-13(19)11-15(17)16(18(20)21)10-12-4-7-14(22-2)8-5-12/h4-9,11,16H,3,10H2,1-2H3/t16-/m1/s1 |
| InChIKey | SVZKNKCHLGZZQF-MRXNPFEDSA-N |
| XLogP | 4.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |