C21H22N2O5 — CID 1273424
(5R)-5-[(2,4-dimethoxyphenyl)methyl]-1-(4-ethylphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 1273424) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is (5R)-5-[(2,4-dimethoxyphenyl)methyl]-1-(4-ethylphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5R)-5-[(2,4-dimethoxyphenyl)methyl]-1-(4-ethylphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 1273424 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | (5R)-5-[(2,4-dimethoxyphenyl)methyl]-1-(4-ethylphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCc1ccc(N2C(=O)NC(=O)[C@@H](Cc3ccc(OC)cc3OC)C2=O)cc1 |
| InChI | InChI=1S/C21H22N2O5/c1-4-13-5-8-15(9-6-13)23-20(25)17(19(24)22-21(23)26)11-14-7-10-16(27-2)12-18(14)28-3/h5-10,12,17H,4,11H2,1-3H3,(H,22,24,26)/t17-/m1/s1 |
| InChIKey | NFQNHGBLQCRMRK-QGZVFWFLSA-N |
| XLogP | 2.71 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|