C22H16Cl3NO — CID 141158846
6-chloro-1,3-bis[(3-chlorophenyl)methyl]-3H-indol-2-one (PubChem CID 141158846) has the molecular formula C22H16Cl3NO and a molecular weight of 416.74 g/mol. Its IUPAC name is 6-chloro-1,3-bis[(3-chlorophenyl)methyl]-3H-indol-2-one.
| Compound Name | 6-chloro-1,3-bis[(3-chlorophenyl)methyl]-3H-indol-2-one |
|---|---|
| PubChem CID | 141158846 |
| Molecular Formula | C22H16Cl3NO |
| Molecular Weight | 416.74 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | 6-chloro-1,3-bis[(3-chlorophenyl)methyl]-3H-indol-2-one |
| SMILES | O=C1C(Cc2cccc(Cl)c2)c2ccc(Cl)cc2N1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H16Cl3NO/c23-16-5-1-3-14(9-16)11-20-19-8-7-18(25)12-21(19)26(22(20)27)13-15-4-2-6-17(24)10-15/h1-10,12,20H,11,13H2 |
| InChIKey | DDYMCVJVFBWYNL-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.74 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |