C23H19ClN2O2 — CID 25053747
(3S)-1,3-dibenzyl-7-chloro-3,4-dihydro-1,4-benzodiazepine-2,5-dione (PubChem CID 25053747) has the molecular formula C23H19ClN2O2 and a molecular weight of 390.87 g/mol. Its IUPAC name is (3S)-1,3-dibenzyl-7-chloro-3,4-dihydro-1,4-benzodiazepine-2,5-dione.
| Compound Name | (3S)-1,3-dibenzyl-7-chloro-3,4-dihydro-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 25053747 |
| Molecular Formula | C23H19ClN2O2 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | (3S)-1,3-dibenzyl-7-chloro-3,4-dihydro-1,4-benzodiazepine-2,5-dione |
| SMILES | O=C1N[C@@H](Cc2ccccc2)C(=O)N(Cc2ccccc2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C23H19ClN2O2/c24-18-11-12-21-19(14-18)22(27)25-20(13-16-7-3-1-4-8-16)23(28)26(21)15-17-9-5-2-6-10-17/h1-12,14,20H,13,15H2,(H,25,27)/t20-/m0/s1 |
| InChIKey | ZUWDJEZGEPQCEO-FQEVSTJZSA-N |
| XLogP | 4.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |