C35H36N2O3 — CID 10369790
(3S)-8-hexyl-3-[(4-hydroxyphenyl)methyl]-1-[(4-phenylphenyl)methyl]-3,4-dihydro-1,4-benzodiazepine-2,5-dione (PubChem CID 10369790) has the molecular formula C35H36N2O3 and a molecular weight of 532.68 g/mol. Its IUPAC name is (3S)-8-hexyl-3-[(4-hydroxyphenyl)methyl]-1-[(4-phenylphenyl)methyl]-3,4-dihydro-1,4-benzodiazepine-2,5-dione.
| Compound Name | (3S)-8-hexyl-3-[(4-hydroxyphenyl)methyl]-1-[(4-phenylphenyl)methyl]-3,4-dihydro-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 10369790 |
| Molecular Formula | C35H36N2O3 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | (3S)-8-hexyl-3-[(4-hydroxyphenyl)methyl]-1-[(4-phenylphenyl)methyl]-3,4-dihydro-1,4-benzodiazepine-2,5-dione |
| SMILES | CCCCCCc1ccc2c(c1)N(Cc1ccc(-c3ccccc3)cc1)C(=O)[C@H](Cc1ccc(O)cc1)NC2=O |
| InChI | InChI=1S/C35H36N2O3/c1-2-3-4-6-9-25-16-21-31-33(23-25)37(24-27-12-17-29(18-13-27)28-10-7-5-8-11-28)35(40)32(36-34(31)39)22-26-14-19-30(38)20-15-26/h5,7-8,10-21,23,32,38H,2-4,6,9,22,24H2,1H3,(H,36,39)/t32-/m0/s1 |
| InChIKey | RKEHEXBZLMTZIL-YTTGMZPUSA-N |
| XLogP | 7.07 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|