C28H32N2O4 — CID 161001871
2-(1-benzyl-2,6-dioxopiperidin-3-yl)-5-octylisoindole-1,3-dione (PubChem CID 161001871) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is 2-(1-benzyl-2,6-dioxopiperidin-3-yl)-5-octylisoindole-1,3-dione.
| Compound Name | 2-(1-benzyl-2,6-dioxopiperidin-3-yl)-5-octylisoindole-1,3-dione |
|---|---|
| PubChem CID | 161001871 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 2-(1-benzyl-2,6-dioxopiperidin-3-yl)-5-octylisoindole-1,3-dione |
| SMILES | CCCCCCCCc1ccc2c(c1)C(=O)N(C1CCC(=O)N(Cc3ccccc3)C1=O)C2=O |
| InChI | InChI=1S/C28H32N2O4/c1-2-3-4-5-6-8-11-20-14-15-22-23(18-20)27(33)30(26(22)32)24-16-17-25(31)29(28(24)34)19-21-12-9-7-10-13-21/h7,9-10,12-15,18,24H,2-6,8,11,16-17,19H2,1H3 |
| InChIKey | JWXIZLKCSVDRQW-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|