C15H14N2O5 — CID 11289629
2-[1-(methoxymethyl)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione (PubChem CID 11289629) has the molecular formula C15H14N2O5 and a molecular weight of 302.29 g/mol. Its IUPAC name is 2-[1-(methoxymethyl)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-(methoxymethyl)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11289629 |
| Molecular Formula | C15H14N2O5 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2-[1-(methoxymethyl)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione |
| SMILES | COCN1C(=O)CCC(N2C(=O)c3ccccc3C2=O)C1=O |
| InChI | InChI=1S/C15H14N2O5/c1-22-8-16-12(18)7-6-11(15(16)21)17-13(19)9-4-2-3-5-10(9)14(17)20/h2-5,11H,6-8H2,1H3 |
| InChIKey | LGMOCBYVQVWKKA-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|