C19H14N4O6 — CID 141276656
[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl pyrimidine-4-carboxylate (PubChem CID 141276656) has the molecular formula C19H14N4O6 and a molecular weight of 394.34 g/mol. Its IUPAC name is [3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl pyrimidine-4-carboxylate.
| Compound Name | [3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 141276656 |
| Molecular Formula | C19H14N4O6 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | [3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl pyrimidine-4-carboxylate |
| SMILES | O=C(OCN1C(=O)CCC(N2C(=O)c3ccccc3C2=O)C1=O)c1ccncn1 |
| InChI | InChI=1S/C19H14N4O6/c24-15-6-5-14(23-16(25)11-3-1-2-4-12(11)17(23)26)18(27)22(15)10-29-19(28)13-7-8-20-9-21-13/h1-4,7-9,14H,5-6,10H2 |
| InChIKey | QJUWUOYBDZNXBM-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 126.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|