C23H26N4O7 — CID 141276609
[(3S)-3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl 2-[(2-pyrrolidin-1-ylacetyl)amino]propanoate (PubChem CID 141276609) has the molecular formula C23H26N4O7 and a molecular weight of 470.48 g/mol. Its IUPAC name is [(3S)-3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl 2-[(2-pyrrolidin-1-ylacetyl)amino]propanoate.
| Compound Name | [(3S)-3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl 2-[(2-pyrrolidin-1-ylacetyl)amino]propanoate |
|---|---|
| PubChem CID | 141276609 |
| Molecular Formula | C23H26N4O7 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | [(3S)-3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl 2-[(2-pyrrolidin-1-ylacetyl)amino]propanoate |
| SMILES | CC(NC(=O)CN1CCCC1)C(=O)OCN1C(=O)CC[C@H](N2C(=O)c3ccccc3C2=O)C1=O |
| InChI | InChI=1S/C23H26N4O7/c1-14(24-18(28)12-25-10-4-5-11-25)23(33)34-13-26-19(29)9-8-17(22(26)32)27-20(30)15-6-2-3-7-16(15)21(27)31/h2-3,6-7,14,17H,4-5,8-13H2,1H3,(H,24,28)/t14?,17-/m0/s1 |
| InChIKey | QBRUSEJBWVEBBB-JRZJBTRGSA-N |
| XLogP | -0.10 |
| TPSA | 133.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|