C23H28N4O7 — CID 66546659
methyl (2S)-2-(2-aminobutanoylamino)-4-[(3S)-3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]-3-methylbutanoate (PubChem CID 66546659) has the molecular formula C23H28N4O7 and a molecular weight of 472.50 g/mol. Its IUPAC name is methyl (2S)-2-(2-aminobutanoylamino)-4-[(3S)-3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-(2-aminobutanoylamino)-4-[(3S)-3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]-3-methylbutanoate |
|---|---|
| PubChem CID | 66546659 |
| Molecular Formula | C23H28N4O7 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | methyl (2S)-2-(2-aminobutanoylamino)-4-[(3S)-3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]-3-methylbutanoate |
| SMILES | CCC(N)C(=O)N[C@H](C(=O)OC)C(C)CN1C(=O)CC[C@H](N2C(=O)c3ccccc3C2=O)C1=O |
| InChI | InChI=1S/C23H28N4O7/c1-4-15(24)19(29)25-18(23(33)34-3)12(2)11-26-17(28)10-9-16(22(26)32)27-20(30)13-7-5-6-8-14(13)21(27)31/h5-8,12,15-16,18H,4,9-11,24H2,1-3H3,(H,25,29)/t12?,15?,16-,18-/m0/s1 |
| InChIKey | JRQFMZHTQISUDV-XJXUWLRGSA-N |
| XLogP | -0.17 |
| TPSA | 156.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|