C21H24N4O7 — CID 141276635
(2S)-2-[[(2S)-2-aminopropanoyl]amino]-2-[[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl]butanoic acid (PubChem CID 141276635) has the molecular formula C21H24N4O7 and a molecular weight of 444.44 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-aminopropanoyl]amino]-2-[[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl]butanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-aminopropanoyl]amino]-2-[[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl]butanoic acid |
|---|---|
| PubChem CID | 141276635 |
| Molecular Formula | C21H24N4O7 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | (2S)-2-[[(2S)-2-aminopropanoyl]amino]-2-[[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl]butanoic acid |
| SMILES | CC[C@@](CN1C(=O)CCC(N2C(=O)c3ccccc3C2=O)C1=O)(NC(=O)[C@H](C)N)C(=O)O |
| InChI | InChI=1S/C21H24N4O7/c1-3-21(20(31)32,23-16(27)11(2)22)10-24-15(26)9-8-14(19(24)30)25-17(28)12-6-4-5-7-13(12)18(25)29/h4-7,11,14H,3,8-10,22H2,1-2H3,(H,23,27)(H,31,32)/t11-,14?,21-/m0/s1 |
| InChIKey | QBVLQIMRDLFREH-RPKZKPFNSA-N |
| XLogP | -0.50 |
| TPSA | 167.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|