C24H28N4O7 — CID 141276668
[(3S)-3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl (2S)-2-(2-pyrrolidin-1-ylpropanoylamino)propanoate (PubChem CID 141276668) has the molecular formula C24H28N4O7 and a molecular weight of 484.51 g/mol. Its IUPAC name is [(3S)-3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl (2S)-2-(2-pyrrolidin-1-ylpropanoylamino)propanoate.
| Compound Name | [(3S)-3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl (2S)-2-(2-pyrrolidin-1-ylpropanoylamino)propanoate |
|---|---|
| PubChem CID | 141276668 |
| Molecular Formula | C24H28N4O7 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | [(3S)-3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl (2S)-2-(2-pyrrolidin-1-ylpropanoylamino)propanoate |
| SMILES | CC(C(=O)N[C@@H](C)C(=O)OCN1C(=O)CC[C@H](N2C(=O)c3ccccc3C2=O)C1=O)N1CCCC1 |
| InChI | InChI=1S/C24H28N4O7/c1-14(25-20(30)15(2)26-11-5-6-12-26)24(34)35-13-27-19(29)10-9-18(23(27)33)28-21(31)16-7-3-4-8-17(16)22(28)32/h3-4,7-8,14-15,18H,5-6,9-13H2,1-2H3,(H,25,30)/t14-,15?,18-/m0/s1 |
| InChIKey | ZEIJQUIAKMAHCT-RARQCXRASA-N |
| XLogP | 0.29 |
| TPSA | 133.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|