C23H28ClN3O6 — CID 68707491
[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl (2S)-3-methyl-2-pyrrolidin-1-ylbutanoate;hydrochloride (PubChem CID 68707491) has the molecular formula C23H28ClN3O6 and a molecular weight of 477.95 g/mol. Its IUPAC name is [3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl (2S)-3-methyl-2-pyrrolidin-1-ylbutanoate;hydrochloride.
| Compound Name | [3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl (2S)-3-methyl-2-pyrrolidin-1-ylbutanoate;hydrochloride |
|---|---|
| PubChem CID | 68707491 |
| Molecular Formula | C23H28ClN3O6 |
| Molecular Weight | 477.95 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | [3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl (2S)-3-methyl-2-pyrrolidin-1-ylbutanoate;hydrochloride |
| SMILES | CC(C)[C@@H](C(=O)OCN1C(=O)CCC(N2C(=O)c3ccccc3C2=O)C1=O)N1CCCC1.Cl |
| InChI | InChI=1S/C23H27N3O6.ClH/c1-14(2)19(24-11-5-6-12-24)23(31)32-13-25-18(27)10-9-17(22(25)30)26-20(28)15-7-3-4-8-16(15)21(26)29;/h3-4,7-8,14,17,19H,5-6,9-13H2,1-2H3;1H/t17?,19-;/m0./s1 |
| InChIKey | NFXQTJJGNZHYLK-YHBSKVLESA-N |
| XLogP | 1.84 |
| TPSA | 104.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.95 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|