C26H32N4O7 — CID 174638599
methyl 4-[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]-3-(2-piperidin-1-ylpropanoylamino)butanoate (PubChem CID 174638599) has the molecular formula C26H32N4O7 and a molecular weight of 512.56 g/mol. Its IUPAC name is methyl 4-[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]-3-(2-piperidin-1-ylpropanoylamino)butanoate.
| Compound Name | methyl 4-[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]-3-(2-piperidin-1-ylpropanoylamino)butanoate |
|---|---|
| PubChem CID | 174638599 |
| Molecular Formula | C26H32N4O7 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | methyl 4-[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]-3-(2-piperidin-1-ylpropanoylamino)butanoate |
| SMILES | COC(=O)CC(CN1C(=O)CCC(N2C(=O)c3ccccc3C2=O)C1=O)NC(=O)C(C)N1CCCCC1 |
| InChI | InChI=1S/C26H32N4O7/c1-16(28-12-6-3-7-13-28)23(33)27-17(14-22(32)37-2)15-29-21(31)11-10-20(26(29)36)30-24(34)18-8-4-5-9-19(18)25(30)35/h4-5,8-9,16-17,20H,3,6-7,10-15H2,1-2H3,(H,27,33) |
| InChIKey | YXAOVRFSXGCAAF-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 133.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|