C26H32N4O7 — CID 141276642
[(3S)-3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl (2S)-2-(2-piperidin-1-ylbutanoylamino)propanoate (PubChem CID 141276642) has the molecular formula C26H32N4O7 and a molecular weight of 512.56 g/mol. Its IUPAC name is [(3S)-3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl (2S)-2-(2-piperidin-1-ylbutanoylamino)propanoate.
| Compound Name | [(3S)-3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl (2S)-2-(2-piperidin-1-ylbutanoylamino)propanoate |
|---|---|
| PubChem CID | 141276642 |
| Molecular Formula | C26H32N4O7 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | [(3S)-3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl (2S)-2-(2-piperidin-1-ylbutanoylamino)propanoate |
| SMILES | CCC(C(=O)N[C@@H](C)C(=O)OCN1C(=O)CC[C@H](N2C(=O)c3ccccc3C2=O)C1=O)N1CCCCC1 |
| InChI | InChI=1S/C26H32N4O7/c1-3-19(28-13-7-4-8-14-28)22(32)27-16(2)26(36)37-15-29-21(31)12-11-20(25(29)35)30-23(33)17-9-5-6-10-18(17)24(30)34/h5-6,9-10,16,19-20H,3-4,7-8,11-15H2,1-2H3,(H,27,32)/t16-,19?,20-/m0/s1 |
| InChIKey | ICGQDIVQUHGOGI-LIXNJBPUSA-N |
| XLogP | 1.07 |
| TPSA | 133.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|