C20H20N2O7 — CID 176626236
[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl oxane-3-carboxylate (PubChem CID 176626236) has the molecular formula C20H20N2O7 and a molecular weight of 400.39 g/mol. Its IUPAC name is [3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl oxane-3-carboxylate.
| Compound Name | [3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl oxane-3-carboxylate |
|---|---|
| PubChem CID | 176626236 |
| Molecular Formula | C20H20N2O7 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | [3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl oxane-3-carboxylate |
| SMILES | O=C(OCN1C(=O)CCC(N2C(=O)c3ccccc3C2=O)C1=O)C1CCCOC1 |
| InChI | InChI=1S/C20H20N2O7/c23-16-8-7-15(22-17(24)13-5-1-2-6-14(13)18(22)25)19(26)21(16)11-29-20(27)12-4-3-9-28-10-12/h1-2,5-6,12,15H,3-4,7-11H2 |
| InChIKey | QHVCZJIHXRFDBW-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|