C25H24N4O7 — CID 68705383
[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl 3-methyl-2-(pyridine-3-carbonylamino)butanoate (PubChem CID 68705383) has the molecular formula C25H24N4O7 and a molecular weight of 492.49 g/mol. Its IUPAC name is [3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl 3-methyl-2-(pyridine-3-carbonylamino)butanoate.
| Compound Name | [3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl 3-methyl-2-(pyridine-3-carbonylamino)butanoate |
|---|---|
| PubChem CID | 68705383 |
| Molecular Formula | C25H24N4O7 |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | [3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]methyl 3-methyl-2-(pyridine-3-carbonylamino)butanoate |
| SMILES | CC(C)C(NC(=O)c1cccnc1)C(=O)OCN1C(=O)CCC(N2C(=O)c3ccccc3C2=O)C1=O |
| InChI | InChI=1S/C25H24N4O7/c1-14(2)20(27-21(31)15-6-5-11-26-12-15)25(35)36-13-28-19(30)10-9-18(24(28)34)29-22(32)16-7-3-4-8-17(16)23(29)33/h3-8,11-12,14,18,20H,9-10,13H2,1-2H3,(H,27,31) |
| InChIKey | AFAMRHOZSQBLJP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 143.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|