C18H22N4O7 — CID 160907229
4-amino-2-[1-(2-hydroxyethyl)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione;(2S)-2-aminopropanoic acid (PubChem CID 160907229) has the molecular formula C18H22N4O7 and a molecular weight of 406.40 g/mol. Its IUPAC name is 4-amino-2-[1-(2-hydroxyethyl)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione;(2S)-2-aminopropanoic acid.
| Compound Name | 4-amino-2-[1-(2-hydroxyethyl)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione;(2S)-2-aminopropanoic acid |
|---|---|
| PubChem CID | 160907229 |
| Molecular Formula | C18H22N4O7 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 4-amino-2-[1-(2-hydroxyethyl)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione;(2S)-2-aminopropanoic acid |
| SMILES | C[C@H](N)C(=O)O.Nc1cccc2c1C(=O)N(C1CCC(=O)N(CCO)C1=O)C2=O |
| InChI | InChI=1S/C15H15N3O5.C3H7NO2/c16-9-3-1-2-8-12(9)15(23)18(13(8)21)10-4-5-11(20)17(6-7-19)14(10)22;1-2(4)3(5)6/h1-3,10,19H,4-7,16H2;2H,4H2,1H3,(H,5,6)/t;2-/m.0/s1 |
| InChIKey | SQHLRYIAVCLLIF-WNQIDUERSA-N |
| XLogP | -1.21 |
| TPSA | 184.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|