C19H20FN3O6 — CID 71126340
2-[3-(4-fluoro-1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]ethyl (2S)-2-(methylamino)propanoate (PubChem CID 71126340) has the molecular formula C19H20FN3O6 and a molecular weight of 405.38 g/mol. Its IUPAC name is 2-[3-(4-fluoro-1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]ethyl (2S)-2-(methylamino)propanoate.
| Compound Name | 2-[3-(4-fluoro-1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]ethyl (2S)-2-(methylamino)propanoate |
|---|---|
| PubChem CID | 71126340 |
| Molecular Formula | C19H20FN3O6 |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 2-[3-(4-fluoro-1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]ethyl (2S)-2-(methylamino)propanoate |
| SMILES | CN[C@@H](C)C(=O)OCCN1C(=O)CCC(N2C(=O)c3cccc(F)c3C2=O)C1=O |
| InChI | InChI=1S/C19H20FN3O6/c1-10(21-2)19(28)29-9-8-22-14(24)7-6-13(17(22)26)23-16(25)11-4-3-5-12(20)15(11)18(23)27/h3-5,10,13,21H,6-9H2,1-2H3/t10-,13?/m0/s1 |
| InChIKey | REHTVYBSZXXKMH-NKUHCKNESA-N |
| XLogP | 0.09 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|