C17H17FN2O5 — CID 139529054
2-[1-(2-ethoxyethyl)-2,6-dioxopiperidin-3-yl]-4-fluoroisoindole-1,3-dione (PubChem CID 139529054) has the molecular formula C17H17FN2O5 and a molecular weight of 348.33 g/mol. Its IUPAC name is 2-[1-(2-ethoxyethyl)-2,6-dioxopiperidin-3-yl]-4-fluoroisoindole-1,3-dione.
| Compound Name | 2-[1-(2-ethoxyethyl)-2,6-dioxopiperidin-3-yl]-4-fluoroisoindole-1,3-dione |
|---|---|
| PubChem CID | 139529054 |
| Molecular Formula | C17H17FN2O5 |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 2-[1-(2-ethoxyethyl)-2,6-dioxopiperidin-3-yl]-4-fluoroisoindole-1,3-dione |
| SMILES | CCOCCN1C(=O)CCC(N2C(=O)c3cccc(F)c3C2=O)C1=O |
| InChI | InChI=1S/C17H17FN2O5/c1-2-25-9-8-19-13(21)7-6-12(16(19)23)20-15(22)10-4-3-5-11(18)14(10)17(20)24/h3-5,12H,2,6-9H2,1H3 |
| InChIKey | ZHYBYDOGOPRYIB-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|