C15H14N2O4 — CID 142650795
4-methyl-2-(1-methyl-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 142650795) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is 4-methyl-2-(1-methyl-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-methyl-2-(1-methyl-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 142650795 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 4-methyl-2-(1-methyl-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | Cc1cccc2c1C(=O)N(C1CCC(=O)N(C)C1=O)C2=O |
| InChI | InChI=1S/C15H14N2O4/c1-8-4-3-5-9-12(8)15(21)17(13(9)19)10-6-7-11(18)16(2)14(10)20/h3-5,10H,6-7H2,1-2H3 |
| InChIKey | HVBHUEKRVNYQRY-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|