C25H35N5O6 — CID 156865742
4-[2-[2-[2-(4-aminopiperidin-1-yl)ethoxy]ethoxy]ethylamino]-2-(1-methyl-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 156865742) has the molecular formula C25H35N5O6 and a molecular weight of 501.58 g/mol. Its IUPAC name is 4-[2-[2-[2-(4-aminopiperidin-1-yl)ethoxy]ethoxy]ethylamino]-2-(1-methyl-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[2-[2-[2-(4-aminopiperidin-1-yl)ethoxy]ethoxy]ethylamino]-2-(1-methyl-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 156865742 |
| Molecular Formula | C25H35N5O6 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | 4-[2-[2-[2-(4-aminopiperidin-1-yl)ethoxy]ethoxy]ethylamino]-2-(1-methyl-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CN1C(=O)CCC(N2C(=O)c3cccc(NCCOCCOCCN4CCC(N)CC4)c3C2=O)C1=O |
| InChI | InChI=1S/C25H35N5O6/c1-28-21(31)6-5-20(24(28)33)30-23(32)18-3-2-4-19(22(18)25(30)34)27-9-13-35-15-16-36-14-12-29-10-7-17(26)8-11-29/h2-4,17,20,27H,5-16,26H2,1H3 |
| InChIKey | ABAJAGBCILVIHD-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 134.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|