C17H19N3O4 — CID 162432126
2-(1-methyl-2,6-dioxopiperidin-3-yl)-4-(propan-2-ylamino)isoindole-1,3-dione (PubChem CID 162432126) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is 2-(1-methyl-2,6-dioxopiperidin-3-yl)-4-(propan-2-ylamino)isoindole-1,3-dione.
| Compound Name | 2-(1-methyl-2,6-dioxopiperidin-3-yl)-4-(propan-2-ylamino)isoindole-1,3-dione |
|---|---|
| PubChem CID | 162432126 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 2-(1-methyl-2,6-dioxopiperidin-3-yl)-4-(propan-2-ylamino)isoindole-1,3-dione |
| SMILES | CC(C)Nc1cccc2c1C(=O)N(C1CCC(=O)N(C)C1=O)C2=O |
| InChI | InChI=1S/C17H19N3O4/c1-9(2)18-11-6-4-5-10-14(11)17(24)20(15(10)22)12-7-8-13(21)19(3)16(12)23/h4-6,9,12,18H,7-8H2,1-3H3 |
| InChIKey | HXSBLJXKCHWBFP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|