C18H15N3O8 — CID 175046688
4-O-[3-(4-amino-1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl] 1-O-methyl (Z)-but-2-enedioate (PubChem CID 175046688) has the molecular formula C18H15N3O8 and a molecular weight of 401.33 g/mol. Its IUPAC name is 4-O-[3-(4-amino-1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl] 1-O-methyl (Z)-but-2-enedioate.
| Compound Name | 4-O-[3-(4-amino-1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl] 1-O-methyl (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 175046688 |
| Molecular Formula | C18H15N3O8 |
| Molecular Weight | 401.33 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 4-O-[3-(4-amino-1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl] 1-O-methyl (Z)-but-2-enedioate |
| SMILES | COC(=O)/C=C\C(=O)ON1C(=O)CCC(N2C(=O)c3cccc(N)c3C2=O)C1=O |
| InChI | InChI=1S/C18H15N3O8/c1-28-13(23)7-8-14(24)29-21-12(22)6-5-11(17(21)26)20-16(25)9-3-2-4-10(19)15(9)18(20)27/h2-4,7-8,11H,5-6,19H2,1H3/b8-7- |
| InChIKey | ZJTWYQMQNZLIKY-FPLPWBNLSA-N |
| XLogP | -0.43 |
| TPSA | 153.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.33 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|