C18H19N3O6 — CID 129190490
2-[3-(4-amino-1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]ethyl propanoate (PubChem CID 129190490) has the molecular formula C18H19N3O6 and a molecular weight of 373.37 g/mol. Its IUPAC name is 2-[3-(4-amino-1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]ethyl propanoate.
| Compound Name | 2-[3-(4-amino-1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]ethyl propanoate |
|---|---|
| PubChem CID | 129190490 |
| Molecular Formula | C18H19N3O6 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 2-[3-(4-amino-1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]ethyl propanoate |
| SMILES | CCC(=O)OCCN1C(=O)CCC(N2C(=O)c3cccc(N)c3C2=O)C1=O |
| InChI | InChI=1S/C18H19N3O6/c1-2-14(23)27-9-8-20-13(22)7-6-12(17(20)25)21-16(24)10-4-3-5-11(19)15(10)18(21)26/h3-5,12H,2,6-9,19H2,1H3 |
| InChIKey | HZYLMFGZFDKBKG-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|