C19H22N4O6 — CID 69247962
2-[3-(4-amino-1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]ethyl 2-(dimethylamino)acetate (PubChem CID 69247962) has the molecular formula C19H22N4O6 and a molecular weight of 402.41 g/mol. Its IUPAC name is 2-[3-(4-amino-1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]ethyl 2-(dimethylamino)acetate.
| Compound Name | 2-[3-(4-amino-1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]ethyl 2-(dimethylamino)acetate |
|---|---|
| PubChem CID | 69247962 |
| Molecular Formula | C19H22N4O6 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 2-[3-(4-amino-1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-1-yl]ethyl 2-(dimethylamino)acetate |
| SMILES | CN(C)CC(=O)OCCN1C(=O)CCC(N2C(=O)c3cccc(N)c3C2=O)C1=O |
| InChI | InChI=1S/C19H22N4O6/c1-21(2)10-15(25)29-9-8-22-14(24)7-6-13(18(22)27)23-17(26)11-4-3-5-12(20)16(11)19(23)28/h3-5,13H,6-10,20H2,1-2H3 |
| InChIKey | BVXHUVHRFJVYHA-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 130.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|